C17H22N8 — CID 123946457
N-(cyclopropylmethyl)-5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-N,1-dimethyl-1,2,4-triazol-3-amine (PubChem CID 123946457) has the molecular formula C17H22N8 and a molecular weight of 338.42 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-N,1-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | N-(cyclopropylmethyl)-5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-N,1-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123946457 |
| Molecular Formula | C17H22N8 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-(cyclopropylmethyl)-5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-N,1-dimethyl-1,2,4-triazol-3-amine |
| SMILES | Cc1ncc(C)n2nc(C=Cc3nc(N(C)CC4CC4)nn3C)nc12 |
| InChI | InChI=1S/C17H22N8/c1-11-9-18-12(2)16-19-14(21-25(11)16)7-8-15-20-17(22-24(15)4)23(3)10-13-5-6-13/h7-9,13H,5-6,10H2,1-4H3 |
| InChIKey | WKBVCGAZDZQFIX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |