About 5,7a-dihydro-1H-isoindole
5,7a-dihydro-1H-isoindole (PubChem CID 123946634) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 5,7a-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 5,7a-dihydro-1H-isoindole |
| PubChem CID | 123946634 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 5,7a-dihydro-1H-isoindole |
| SMILES | C1=CC2CN=CC2=CC1 |
| InChI | InChI=1S/C8H9N/c1-2-4-8-6-9-5-7(8)3-1/h1,3-4,6-7H,2,5H2 |
| InChIKey | KKJDQXSRICFJHI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,7a-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7a-dihydro-1H-isoindole?
The IUPAC name of 5,7a-dihydro-1H-isoindole (CID 123946634) is 5,7a-dihydro-1H-isoindole.
What is the SMILES notation for 5,7a-dihydro-1H-isoindole?
The canonical SMILES for 5,7a-dihydro-1H-isoindole is C1=CC2CN=CC2=CC1.
What is the InChIKey of 5,7a-dihydro-1H-isoindole?
The InChIKey is KKJDQXSRICFJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-2-4-8-6-9-5-7(8)3-1/h1,3-4,6-7H,2,5H2.
What are the key properties of 5,7a-dihydro-1H-isoindole?
5,7a-dihydro-1H-isoindole has a molecular weight of 119.17 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7a-dihydro-1H-isoindole is sourced from PubChem (CID 123946634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).