About N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine
N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine (PubChem CID 123946687) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine.
Molecular Properties
| Compound Name | N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine |
| PubChem CID | 123946687 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine |
| SMILES | C=NC1=NC2CCN(C2)/C1=C/C |
| InChI | InChI=1S/C9H13N3/c1-3-8-9(10-2)11-7-4-5-12(8)6-7/h3,7H,2,4-6H2,1H3/b8-3+ |
| InChIKey | LASILYQIIOGXMU-FPYGCLRLSA-N |
| XLogP | 1.08 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine?
The IUPAC name of N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine (CID 123946687) is N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine.
What is the SMILES notation for N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine?
The canonical SMILES for N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine is C=NC1=NC2CCN(C2)/C1=C/C.
What is the InChIKey of N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine?
The InChIKey is LASILYQIIOGXMU-FPYGCLRLSA-N. The full InChI is InChI=1S/C9H13N3/c1-3-8-9(10-2)11-7-4-5-12(8)6-7/h3,7H,2,4-6H2,1H3/b8-3+.
What are the key properties of N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine?
N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine has a molecular weight of 163.22 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-2-ethylidene-1,4-diazabicyclo[3.2.1]oct-3-en-3-yl]methanimine is sourced from PubChem (CID 123946687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).