About 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide
4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide (PubChem CID 123946707) has the molecular formula C16H24F3N3O2
and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide.
Molecular Properties
| Compound Name | 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide |
| PubChem CID | 123946707 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide |
| SMILES | CCC(=CC(=CCF)C(=O)NCCN1CCNCC1=O)C(C)(F)F |
| InChI | InChI=1S/C16H24F3N3O2/c1-3-13(16(2,18)19)10-12(4-5-17)15(24)21-7-9-22-8-6-20-11-14(22)23/h4,10,20H,3,5-9,11H2,1-2H3,(H,21,24) |
| InChIKey | LVVBHCRRAHDVOD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide?
The IUPAC name of 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide (CID 123946707) is 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide.
What is the SMILES notation for 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide?
The canonical SMILES for 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide is CCC(=CC(=CCF)C(=O)NCCN1CCNCC1=O)C(C)(F)F.
What is the InChIKey of 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide?
The InChIKey is LVVBHCRRAHDVOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F3N3O2/c1-3-13(16(2,18)19)10-12(4-5-17)15(24)21-7-9-22-8-6-20-11-14(22)23/h4,10,20H,3,5-9,11H2,1-2H3,(H,21,24).
What are the key properties of 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide?
4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide has a molecular weight of 347.38 g/mol, XLogP of 1.42, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5,5-difluoro-2-(2-fluoroethylidene)-N-[2-(2-oxopiperazin-1-yl)ethyl]hex-3-enamide is sourced from PubChem (CID 123946707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).