About ethane;prop-2-enyl piperidine-1-carboxylate
ethane;prop-2-enyl piperidine-1-carboxylate (PubChem CID 123947204) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is ethane;prop-2-enyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;prop-2-enyl piperidine-1-carboxylate |
| PubChem CID | 123947204 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | ethane;prop-2-enyl piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCCCC1.CC |
| InChI | InChI=1S/C9H15NO2.C2H6/c1-2-8-12-9(11)10-6-4-3-5-7-10;1-2/h2H,1,3-8H2;1-2H3 |
| InChIKey | HNVDRKWJVPGPRV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;prop-2-enyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;prop-2-enyl piperidine-1-carboxylate?
The IUPAC name of ethane;prop-2-enyl piperidine-1-carboxylate (CID 123947204) is ethane;prop-2-enyl piperidine-1-carboxylate.
What is the SMILES notation for ethane;prop-2-enyl piperidine-1-carboxylate?
The canonical SMILES for ethane;prop-2-enyl piperidine-1-carboxylate is C=CCOC(=O)N1CCCCC1.CC.
What is the InChIKey of ethane;prop-2-enyl piperidine-1-carboxylate?
The InChIKey is HNVDRKWJVPGPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.C2H6/c1-2-8-12-9(11)10-6-4-3-5-7-10;1-2/h2H,1,3-8H2;1-2H3.
What are the key properties of ethane;prop-2-enyl piperidine-1-carboxylate?
ethane;prop-2-enyl piperidine-1-carboxylate has a molecular weight of 199.29 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;prop-2-enyl piperidine-1-carboxylate is sourced from PubChem (CID 123947204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).