C17H13FN4O6 — CID 123947462
N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-4-(trihydroxymethoxy)pyridine-2-carboxamide (PubChem CID 123947462) has the molecular formula C17H13FN4O6 and a molecular weight of 388.31 g/mol. Its IUPAC name is N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-4-(trihydroxymethoxy)pyridine-2-carboxamide.
| Compound Name | N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-4-(trihydroxymethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123947462 |
| Molecular Formula | C17H13FN4O6 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | N-(3-fluoro-5-pyrimidin-5-yloxyphenyl)-4-(trihydroxymethoxy)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(Oc2cncnc2)c1)c1cc(OC(O)(O)O)ccn1 |
| InChI | InChI=1S/C17H13FN4O6/c18-10-3-11(5-13(4-10)27-14-7-19-9-20-8-14)22-16(23)15-6-12(1-2-21-15)28-17(24,25)26/h1-9,24-26H,(H,22,23) |
| InChIKey | CNTCZKXHSYZJSJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|