About 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole
1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole (PubChem CID 123947569) has the molecular formula C21H41N
and a molecular weight of 307.57 g/mol. Its IUPAC name is 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole |
| PubChem CID | 123947569 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole |
| SMILES | CCCCCCCCC1C(C)C(CCCC)=CN1CCCC |
| InChI | InChI=1S/C21H41N/c1-5-8-11-12-13-14-16-21-19(4)20(15-9-6-2)18-22(21)17-10-7-3/h18-19,21H,5-17H2,1-4H3 |
| InChIKey | ZCJBCRPXEKGCME-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole?
The IUPAC name of 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole (CID 123947569) is 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole.
What is the SMILES notation for 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole?
The canonical SMILES for 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole is CCCCCCCCC1C(C)C(CCCC)=CN1CCCC.
What is the InChIKey of 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole?
The InChIKey is ZCJBCRPXEKGCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41N/c1-5-8-11-12-13-14-16-21-19(4)20(15-9-6-2)18-22(21)17-10-7-3/h18-19,21H,5-17H2,1-4H3.
What are the key properties of 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole?
1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole has a molecular weight of 307.57 g/mol, XLogP of 6.93, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibutyl-3-methyl-2-octyl-2,3-dihydropyrrole is sourced from PubChem (CID 123947569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).