About ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate
ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate (PubChem CID 123947616) has the molecular formula C25H20F5NO3
and a molecular weight of 477.43 g/mol. Its IUPAC name is ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate |
| PubChem CID | 123947616 |
| Molecular Formula | C25H20F5NO3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate |
| SMILES | CCOC(=O)C/C(=N\c1ccc(F)c(F)c1)c1ccc(Cc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H20F5NO3/c1-2-33-24(32)15-23(31-19-9-12-21(26)22(27)14-19)18-7-3-16(4-8-18)13-17-5-10-20(11-6-17)34-25(28,29)30/h3-12,14H,2,13,15H2,1H3/b31-23+ |
| InChIKey | GANCJCQZLJSHRH-UQRQXUALSA-N |
| XLogP | 6.53 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate?
The IUPAC name of ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate (CID 123947616) is ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate.
What is the SMILES notation for ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate?
The canonical SMILES for ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate is CCOC(=O)C/C(=N\c1ccc(F)c(F)c1)c1ccc(Cc2ccc(OC(F)(F)F)cc2)cc1.
What is the InChIKey of ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate?
The InChIKey is GANCJCQZLJSHRH-UQRQXUALSA-N. The full InChI is InChI=1S/C25H20F5NO3/c1-2-33-24(32)15-23(31-19-9-12-21(26)22(27)14-19)18-7-3-16(4-8-18)13-17-5-10-20(11-6-17)34-25(28,29)30/h3-12,14H,2,13,15H2,1H3/b31-23+.
What are the key properties of ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate?
ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate has a molecular weight of 477.43 g/mol, XLogP of 6.53, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(3,4-difluorophenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate is sourced from PubChem (CID 123947616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).