C18H34FNO4 — CID 123947886
3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one (PubChem CID 123947886) has the molecular formula C18H34FNO4 and a molecular weight of 347.47 g/mol. Its IUPAC name is 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one.
| Compound Name | 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one |
|---|---|
| PubChem CID | 123947886 |
| Molecular Formula | C18H34FNO4 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one |
| SMILES | CCCCC1C(C)OC(=O)C(N)COCC1OCCCC(C)(C)F |
| InChI | InChI=1S/C18H34FNO4/c1-5-6-8-14-13(2)24-17(21)15(20)11-22-12-16(14)23-10-7-9-18(3,4)19/h13-16H,5-12,20H2,1-4H3 |
| InChIKey | RPFQGLXZOACGRQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|