About 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one
3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one (PubChem CID 123947886) has the molecular formula C18H34FNO4
and a molecular weight of 347.47 g/mol. Its IUPAC name is 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one.
Molecular Properties
| Compound Name | 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one |
| PubChem CID | 123947886 |
| Molecular Formula | C18H34FNO4 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one |
| SMILES | CCCCC1C(C)OC(=O)C(N)COCC1OCCCC(C)(C)F |
| InChI | InChI=1S/C18H34FNO4/c1-5-6-8-14-13(2)24-17(21)15(20)11-22-12-16(14)23-10-7-9-18(3,4)19/h13-16H,5-12,20H2,1-4H3 |
| InChIKey | RPFQGLXZOACGRQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one?
The IUPAC name of 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one (CID 123947886) is 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one.
What is the SMILES notation for 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one?
The canonical SMILES for 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one is CCCCC1C(C)OC(=O)C(N)COCC1OCCCC(C)(C)F.
What is the InChIKey of 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one?
The InChIKey is RPFQGLXZOACGRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34FNO4/c1-5-6-8-14-13(2)24-17(21)15(20)11-22-12-16(14)23-10-7-9-18(3,4)19/h13-16H,5-12,20H2,1-4H3.
What are the key properties of 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one?
3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one has a molecular weight of 347.47 g/mol, XLogP of 3.00, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-8-butyl-7-(4-fluoro-4-methylpentoxy)-9-methyl-1,5-dioxonan-2-one is sourced from PubChem (CID 123947886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).