C13H34N4Si — CID 123948151
2-methyl-1-N,1-N',1-N"-tri(propan-2-yl)-2-N-silylpropane-1,1,1,2-tetramine (PubChem CID 123948151) has the molecular formula C13H34N4Si and a molecular weight of 274.53 g/mol. Its IUPAC name is 2-methyl-1-N,1-N',1-N"-tri(propan-2-yl)-2-N-silylpropane-1,1,1,2-tetramine.
| Compound Name | 2-methyl-1-N,1-N',1-N"-tri(propan-2-yl)-2-N-silylpropane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 123948151 |
| Molecular Formula | C13H34N4Si |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | 2-methyl-1-N,1-N',1-N"-tri(propan-2-yl)-2-N-silylpropane-1,1,1,2-tetramine |
| SMILES | CC(C)NC(NC(C)C)(NC(C)C)C(C)(C)N[SiH3] |
| InChI | InChI=1S/C13H34N4Si/c1-9(2)14-13(15-10(3)4,16-11(5)6)12(7,8)17-18/h9-11,14-17H,1-8,18H3 |
| InChIKey | CGRMEZZEZOXUEB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|