C19H23FN+ — CID 123948511
8,8-diethyl-4-(fluoromethyl)-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium (PubChem CID 123948511) has the molecular formula C19H23FN+ and a molecular weight of 284.40 g/mol. Its IUPAC name is 8,8-diethyl-4-(fluoromethyl)-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium.
| Compound Name | 8,8-diethyl-4-(fluoromethyl)-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium |
|---|---|
| PubChem CID | 123948511 |
| Molecular Formula | C19H23FN+ |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 8,8-diethyl-4-(fluoromethyl)-6,7-dihydropyrido[2,1-a][2]benzazepin-5-ium |
| SMILES | CCC1(CC)CC[n+]2c(CF)cccc2-c2ccccc21 |
| InChI | InChI=1S/C19H23FN/c1-3-19(4-2)12-13-21-15(14-20)8-7-11-18(21)16-9-5-6-10-17(16)19/h5-11H,3-4,12-14H2,1-2H3/q+1 |
| InChIKey | CCHFADOSCSBPIW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|