C15H16FN3O2 — CID 123948907
5-[3-[4-fluoro-2-(hydroxymethyl)phenoxy]propyl]-4-methyl-1H-pyrazole-3-carbonitrile (PubChem CID 123948907) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 5-[3-[4-fluoro-2-(hydroxymethyl)phenoxy]propyl]-4-methyl-1H-pyrazole-3-carbonitrile.
| Compound Name | 5-[3-[4-fluoro-2-(hydroxymethyl)phenoxy]propyl]-4-methyl-1H-pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 123948907 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-[3-[4-fluoro-2-(hydroxymethyl)phenoxy]propyl]-4-methyl-1H-pyrazole-3-carbonitrile |
| SMILES | Cc1c(C#N)n[nH]c1CCCOc1ccc(F)cc1CO |
| InChI | InChI=1S/C15H16FN3O2/c1-10-13(18-19-14(10)8-17)3-2-6-21-15-5-4-12(16)7-11(15)9-20/h4-5,7,20H,2-3,6,9H2,1H3,(H,18,19) |
| InChIKey | DCXXLYRLMHHPRO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|