About [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate
[4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate (PubChem CID 123949108) has the molecular formula C14H17BrN2O2
and a molecular weight of 325.21 g/mol. Its IUPAC name is [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate |
| PubChem CID | 123949108 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate |
| SMILES | CC=C(/N=C/C)c1cc(Br)ccc1OC(=O)N(C)C |
| InChI | InChI=1S/C14H17BrN2O2/c1-5-12(16-6-2)11-9-10(15)7-8-13(11)19-14(18)17(3)4/h5-9H,1-4H3/b12-5?,16-6+ |
| InChIKey | AMWFCDVMWXHOIW-WKYZAMNCSA-N |
| XLogP | 3.96 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate?
The IUPAC name of [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate (CID 123949108) is [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate.
What is the SMILES notation for [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate?
The canonical SMILES for [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate is CC=C(/N=C/C)c1cc(Br)ccc1OC(=O)N(C)C.
What is the InChIKey of [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate?
The InChIKey is AMWFCDVMWXHOIW-WKYZAMNCSA-N. The full InChI is InChI=1S/C14H17BrN2O2/c1-5-12(16-6-2)11-9-10(15)7-8-13(11)19-14(18)17(3)4/h5-9H,1-4H3/b12-5?,16-6+.
What are the key properties of [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate?
[4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate has a molecular weight of 325.21 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-2-[1-(ethylideneamino)prop-1-enyl]phenyl] N,N-dimethylcarbamate is sourced from PubChem (CID 123949108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).