C8H4Cl3F3 — CID 123950202
1,2,3-trichloro-5-(2,2,2-trifluoroethyl)benzene (PubChem CID 123950202) has the molecular formula C8H4Cl3F3 and a molecular weight of 263.47 g/mol. Its IUPAC name is 1,2,3-trichloro-5-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 1,2,3-trichloro-5-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 123950202 |
| Molecular Formula | C8H4Cl3F3 |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 261.93 |
| IUPAC Name | 1,2,3-trichloro-5-(2,2,2-trifluoroethyl)benzene |
| SMILES | FC(F)(F)Cc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H4Cl3F3/c9-5-1-4(3-8(12,13)14)2-6(10)7(5)11/h1-2H,3H2 |
| InChIKey | ZWJBVBBIDVTVAR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|