C27H16F5N3O2 — CID 123950404
N-(2-benzyl-8-oxo-1H-benzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 123950404) has the molecular formula C27H16F5N3O2 and a molecular weight of 509.43 g/mol. Its IUPAC name is N-(2-benzyl-8-oxo-1H-benzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(2-benzyl-8-oxo-1H-benzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 123950404 |
| Molecular Formula | C27H16F5N3O2 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | N-(2-benzyl-8-oxo-1H-benzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1nc2ccc3cc(=O)ccc3c2[nH]c1Cc1ccccc1 |
| InChI | InChI=1S/C27H16F5N3O2/c28-21-17(22(29)24(31)25(32)23(21)30)12-20(37)35-27-19(10-13-4-2-1-3-5-13)33-26-16-8-7-15(36)11-14(16)6-9-18(26)34-27/h1-9,11,33H,10,12H2,(H,35,37) |
| InChIKey | MDHGCFZDFQEZME-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|