C68H48N8O6 — CID 123950468
4-[10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile (PubChem CID 123950468) has the molecular formula C68H48N8O6 and a molecular weight of 1073.18 g/mol. Its IUPAC name is 4-[10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile.
| Compound Name | 4-[10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 123950468 |
| Molecular Formula | C68H48N8O6 |
| Molecular Weight | 1073.18 g/mol |
| Exact Mass | 1072.37 |
| IUPAC Name | 4-[10,20-bis[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(C2=c3ccc([nH]3)=C(c3ccc(OCCCN4C(=O)c5ccccc5C4=O)cc3)c3ccc([nH]3)C(c3ccc(C#N)cc3)=c3ccc([nH]3)=C(c3ccc(OCCCN4C(=O)c5ccccc5C4=O)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C68H48N8O6/c1-70-46-22-16-43(17-23-46)62-55-30-34-59(73-55)63(44-18-24-47(25-19-44)81-38-6-36-75-65(77)49-8-2-3-9-50(49)66(75)78)57-32-28-53(71-57)61(42-14-12-41(40-69)13-15-42)54-29-33-58(72-54)64(60-35-31-56(62)74-60)45-20-26-48(27-21-45)82-39-7-37-76-67(79)51-10-4-5-11-52(51)68(76)80/h2-5,8-35,71-74H,6-7,36-39H2 |
| InChIKey | NQKFHCOERGXIPO-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 184.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.18 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|