C23H23NO5 — CID 123950809
methyl 2-[13-[4-(dihydroxymethyl)-3-methyl-1,2-oxazol-5-yl]-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]acetate (PubChem CID 123950809) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl 2-[13-[4-(dihydroxymethyl)-3-methyl-1,2-oxazol-5-yl]-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]acetate.
| Compound Name | methyl 2-[13-[4-(dihydroxymethyl)-3-methyl-1,2-oxazol-5-yl]-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]acetate |
|---|---|
| PubChem CID | 123950809 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | methyl 2-[13-[4-(dihydroxymethyl)-3-methyl-1,2-oxazol-5-yl]-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)CCCc1cc(-c3onc(C)c3C(O)O)ccc1-2 |
| InChI | InChI=1S/C23H23NO5/c1-13-21(23(26)27)22(29-24-13)17-7-9-19-16(12-17)5-3-4-15-10-14(6-8-18(15)19)11-20(25)28-2/h6-10,12,23,26-27H,3-5,11H2,1-2H3 |
| InChIKey | FBCMSHUZLXCEQY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|