C16H22 — CID 123951420
1-(2-cyclobutylethyl)-1,2,5,6-tetrahydronaphthalene (PubChem CID 123951420) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(2-cyclobutylethyl)-1,2,5,6-tetrahydronaphthalene.
| Compound Name | 1-(2-cyclobutylethyl)-1,2,5,6-tetrahydronaphthalene |
|---|---|
| PubChem CID | 123951420 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-(2-cyclobutylethyl)-1,2,5,6-tetrahydronaphthalene |
| SMILES | C1=CC2=C(C=CCC2CCC2CCC2)CC1 |
| InChI | InChI=1S/C16H22/c1-2-10-16-14(7-1)8-4-9-15(16)12-11-13-5-3-6-13/h2,4,8,10,13,15H,1,3,5-7,9,11-12H2 |
| InChIKey | WVSBJPRTTJYWQF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |