About [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate
[2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate (PubChem CID 123951459) has the molecular formula C17H13F2NO5S
and a molecular weight of 381.36 g/mol. Its IUPAC name is [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate.
Molecular Properties
| Compound Name | [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate |
| PubChem CID | 123951459 |
| Molecular Formula | C17H13F2NO5S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate |
| SMILES | Nc1oc(-c2ccc(F)cc2F)c(O)c1OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H13F2NO5S/c18-11-6-7-12(13(19)8-11)15-14(21)16(17(20)24-15)25-26(22,23)9-10-4-2-1-3-5-10/h1-8,21H,9,20H2 |
| InChIKey | VBTULZBBGOXVHS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate?
The IUPAC name of [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate (CID 123951459) is [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate.
What is the SMILES notation for [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate?
The canonical SMILES for [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate is Nc1oc(-c2ccc(F)cc2F)c(O)c1OS(=O)(=O)Cc1ccccc1.
What is the InChIKey of [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate?
The InChIKey is VBTULZBBGOXVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2NO5S/c18-11-6-7-12(13(19)8-11)15-14(21)16(17(20)24-15)25-26(22,23)9-10-4-2-1-3-5-10/h1-8,21H,9,20H2.
What are the key properties of [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate?
[2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate has a molecular weight of 381.36 g/mol, XLogP of 3.42, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-5-(2,4-difluorophenyl)-4-hydroxyfuran-3-yl] phenylmethanesulfonate is sourced from PubChem (CID 123951459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).