C19H18ClNOS2 — CID 123952076
5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-cyclopentyl-1,3-thiazolidine-2-thione (PubChem CID 123952076) has the molecular formula C19H18ClNOS2 and a molecular weight of 375.95 g/mol. Its IUPAC name is 5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-cyclopentyl-1,3-thiazolidine-2-thione.
| Compound Name | 5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-cyclopentyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 123952076 |
| Molecular Formula | C19H18ClNOS2 |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-cyclopentyl-1,3-thiazolidine-2-thione |
| SMILES | S=C1SC(=Cc2ccc(-c3ccc(Cl)cc3)o2)CN1C1CCCC1 |
| InChI | InChI=1S/C19H18ClNOS2/c20-14-7-5-13(6-8-14)18-10-9-16(22-18)11-17-12-21(19(23)24-17)15-3-1-2-4-15/h5-11,15H,1-4,12H2 |
| InChIKey | MIDQOOAIUPHAOD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|