C32H40N4O5 — CID 123952217
2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide (PubChem CID 123952217) has the molecular formula C32H40N4O5 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide.
| Compound Name | 2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 123952217 |
| Molecular Formula | C32H40N4O5 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]-1-methylpyrrol-2-yl]-N-[(3,4,5-trihydroxyoxan-2-yl)methyl]but-2-enamide |
| SMILES | CCCN(CCC)c1ccc2cc(-c3ccc(C(C)=C(C#N)C(=O)NCC4OCC(O)C(O)C4O)n3C)ccc2c1 |
| InChI | InChI=1S/C32H40N4O5/c1-5-13-36(14-6-2)24-10-9-21-15-23(8-7-22(21)16-24)27-12-11-26(35(27)4)20(3)25(17-33)32(40)34-18-29-31(39)30(38)28(37)19-41-29/h7-12,15-16,28-31,37-39H,5-6,13-14,18-19H2,1-4H3,(H,34,40) |
| InChIKey | LHVOXDUDWFKRTB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|