About 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone
1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone (PubChem CID 123952241) has the molecular formula C17H16BrClO2
and a molecular weight of 367.67 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone |
| PubChem CID | 123952241 |
| Molecular Formula | C17H16BrClO2 |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone |
| SMILES | CC1=C(Cl)C(OCC(=O)c2ccc(Br)cc2)=CC=CCC1 |
| InChI | InChI=1S/C17H16BrClO2/c1-12-5-3-2-4-6-16(17(12)19)21-11-15(20)13-7-9-14(18)10-8-13/h2,4,6-10H,3,5,11H2,1H3 |
| InChIKey | XDCIIIFCYPDQOV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone?
The IUPAC name of 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone (CID 123952241) is 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone.
What is the SMILES notation for 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone?
The canonical SMILES for 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone is CC1=C(Cl)C(OCC(=O)c2ccc(Br)cc2)=CC=CCC1.
What is the InChIKey of 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone?
The InChIKey is XDCIIIFCYPDQOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrClO2/c1-12-5-3-2-4-6-16(17(12)19)21-11-15(20)13-7-9-14(18)10-8-13/h2,4,6-10H,3,5,11H2,1H3.
What are the key properties of 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone?
1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone has a molecular weight of 367.67 g/mol, XLogP of 5.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(8-chloro-7-methylcycloocta-1,3,7-trien-1-yl)oxyethanone is sourced from PubChem (CID 123952241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).