About 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid
5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid (PubChem CID 123952424) has the molecular formula C7H6F2N2O4
and a molecular weight of 220.13 g/mol. Its IUPAC name is 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid |
| PubChem CID | 123952424 |
| Molecular Formula | C7H6F2N2O4 |
| Molecular Weight | 220.13 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(F)(F)C(O)O)cn1 |
| InChI | InChI=1S/C7H6F2N2O4/c8-7(9,6(14)15)4-2-10-3(1-11-4)5(12)13/h1-2,6,14-15H,(H,12,13) |
| InChIKey | ORYILZBTBQMJOR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.13 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid?
The IUPAC name of 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid (CID 123952424) is 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid.
What is the SMILES notation for 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid?
The canonical SMILES for 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid is O=C(O)c1cnc(C(F)(F)C(O)O)cn1.
What is the InChIKey of 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid?
The InChIKey is ORYILZBTBQMJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N2O4/c8-7(9,6(14)15)4-2-10-3(1-11-4)5(12)13/h1-2,6,14-15H,(H,12,13).
What are the key properties of 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid?
5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid has a molecular weight of 220.13 g/mol, XLogP of -0.42, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoro-2,2-dihydroxyethyl)pyrazine-2-carboxylic acid is sourced from PubChem (CID 123952424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).