C18H32O4 — CID 123952538
dipropyl 2,3-bis(2-methylpropyl)but-2-enedioate (PubChem CID 123952538) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is dipropyl 2,3-bis(2-methylpropyl)but-2-enedioate.
| Compound Name | dipropyl 2,3-bis(2-methylpropyl)but-2-enedioate |
|---|---|
| PubChem CID | 123952538 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | dipropyl 2,3-bis(2-methylpropyl)but-2-enedioate |
| SMILES | CCCOC(=O)C(CC(C)C)=C(CC(C)C)C(=O)OCCC |
| InChI | InChI=1S/C18H32O4/c1-7-9-21-17(19)15(11-13(3)4)16(12-14(5)6)18(20)22-10-8-2/h13-14H,7-12H2,1-6H3 |
| InChIKey | OIAZSEZFLMMGFA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|