About 2-cyano-N',3-dimethylbut-2-enimidamide
2-cyano-N',3-dimethylbut-2-enimidamide (PubChem CID 123952684) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-cyano-N',3-dimethylbut-2-enimidamide.
Molecular Properties
| Compound Name | 2-cyano-N',3-dimethylbut-2-enimidamide |
| PubChem CID | 123952684 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2-cyano-N',3-dimethylbut-2-enimidamide |
| SMILES | C/N=C(\N)C(C#N)=C(C)C |
| InChI | InChI=1S/C7H11N3/c1-5(2)6(4-8)7(9)10-3/h1-3H3,(H2,9,10) |
| InChIKey | NUMNJKDXIUQSJR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N',3-dimethylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N',3-dimethylbut-2-enimidamide?
The IUPAC name of 2-cyano-N',3-dimethylbut-2-enimidamide (CID 123952684) is 2-cyano-N',3-dimethylbut-2-enimidamide.
What is the SMILES notation for 2-cyano-N',3-dimethylbut-2-enimidamide?
The canonical SMILES for 2-cyano-N',3-dimethylbut-2-enimidamide is C/N=C(\N)C(C#N)=C(C)C.
What is the InChIKey of 2-cyano-N',3-dimethylbut-2-enimidamide?
The InChIKey is NUMNJKDXIUQSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-5(2)6(4-8)7(9)10-3/h1-3H3,(H2,9,10).
What are the key properties of 2-cyano-N',3-dimethylbut-2-enimidamide?
2-cyano-N',3-dimethylbut-2-enimidamide has a molecular weight of 137.19 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N',3-dimethylbut-2-enimidamide is sourced from PubChem (CID 123952684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).