C16H20N6O2 — CID 123952793
N-(aminomethylidene)-12-methoxy-N'-propan-2-yl-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene-4-carboximidamide (PubChem CID 123952793) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is N-(aminomethylidene)-12-methoxy-N'-propan-2-yl-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene-4-carboximidamide.
| Compound Name | N-(aminomethylidene)-12-methoxy-N'-propan-2-yl-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene-4-carboximidamide |
|---|---|
| PubChem CID | 123952793 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-(aminomethylidene)-12-methoxy-N'-propan-2-yl-9-oxa-3,6,13-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2,4,10,12-pentaene-4-carboximidamide |
| SMILES | COc1cc2c(cn1)-c1nc(C(=N/C(C)C)/N=C/N)cn1CCO2 |
| InChI | InChI=1S/C16H20N6O2/c1-10(2)20-15(19-9-17)12-8-22-4-5-24-13-6-14(23-3)18-7-11(13)16(22)21-12/h6-10H,4-5H2,1-3H3,(H2,17,19,20) |
| InChIKey | CZYGLEOQPBRYKV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|