C17H22BrFN2O2 — CID 123953382
tert-butyl 6-(5-bromo-6-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 123953382) has the molecular formula C17H22BrFN2O2 and a molecular weight of 385.28 g/mol. Its IUPAC name is tert-butyl 6-(5-bromo-6-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 6-(5-bromo-6-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 123953382 |
| Molecular Formula | C17H22BrFN2O2 |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | tert-butyl 6-(5-bromo-6-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1C(c1cnc(F)c(Br)c1)C2 |
| InChI | InChI=1S/C17H22BrFN2O2/c1-17(2,3)23-16(22)21-11-5-4-6-14(21)12(8-11)10-7-13(18)15(19)20-9-10/h7,9,11-12,14H,4-6,8H2,1-3H3 |
| InChIKey | PJSWFCVSCQCSIC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|