C7H12NO+ — CID 123953721
4-methoxy-N,3-dimethylbut-3-enenitrilium (PubChem CID 123953721) has the molecular formula C7H12NO+ and a molecular weight of 126.18 g/mol. Its IUPAC name is 4-methoxy-N,3-dimethylbut-3-enenitrilium.
| Compound Name | 4-methoxy-N,3-dimethylbut-3-enenitrilium |
|---|---|
| PubChem CID | 123953721 |
| Molecular Formula | C7H12NO+ |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 4-methoxy-N,3-dimethylbut-3-enenitrilium |
| SMILES | C[N+]#CCC(C)=COC |
| InChI | InChI=1S/C7H12NO/c1-7(6-9-3)4-5-8-2/h6H,4H2,1-3H3/q+1 |
| InChIKey | YWVDLEGZRRCRFE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|