C9H4F6N2O2 — CID 123953924
4,4,4-trifluoro-1-[6-(trifluoromethyl)pyrimidin-4-yl]butane-1,3-dione (PubChem CID 123953924) has the molecular formula C9H4F6N2O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[6-(trifluoromethyl)pyrimidin-4-yl]butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-[6-(trifluoromethyl)pyrimidin-4-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 123953924 |
| Molecular Formula | C9H4F6N2O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 4,4,4-trifluoro-1-[6-(trifluoromethyl)pyrimidin-4-yl]butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1cc(C(F)(F)F)ncn1 |
| InChI | InChI=1S/C9H4F6N2O2/c10-8(11,12)6-1-4(16-3-17-6)5(18)2-7(19)9(13,14)15/h1,3H,2H2 |
| InChIKey | PAWJRURSYOQEOF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|