C33H25F2N3O — CID 123954033
1-[5-(16-fluoro-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-(4-fluorophenyl)-6-methyl-1-benzofuran-3-yl]ethanimine (PubChem CID 123954033) has the molecular formula C33H25F2N3O and a molecular weight of 517.58 g/mol. Its IUPAC name is 1-[5-(16-fluoro-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-(4-fluorophenyl)-6-methyl-1-benzofuran-3-yl]ethanimine.
| Compound Name | 1-[5-(16-fluoro-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-(4-fluorophenyl)-6-methyl-1-benzofuran-3-yl]ethanimine |
|---|---|
| PubChem CID | 123954033 |
| Molecular Formula | C33H25F2N3O |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 1-[5-(16-fluoro-3,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-(4-fluorophenyl)-6-methyl-1-benzofuran-3-yl]ethanimine |
| SMILES | [H]/N=C(\C)c1c(-c2ccc(F)cc2)oc2cc(C)c(-c3ccc4c(n3)-c3cc5c(F)cccc5n3CCC4)cc12 |
| InChI | InChI=1S/C33H25F2N3O/c1-18-15-30-25(31(19(2)36)33(39-30)21-8-11-22(34)12-9-21)16-23(18)27-13-10-20-5-4-14-38-28-7-3-6-26(35)24(28)17-29(38)32(20)37-27/h3,6-13,15-17,36H,4-5,14H2,1-2H3/b36-19+ |
| InChIKey | GEUFOMYYAIMTPR-ODNPBWNPSA-N |
| XLogP | 8.70 |
| TPSA | 54.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|