About 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane
2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane (PubChem CID 123954152) has the molecular formula C25H32N2O4S2
and a molecular weight of 488.68 g/mol. Its IUPAC name is 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane.
Molecular Properties
| Compound Name | 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane |
| PubChem CID | 123954152 |
| Molecular Formula | C25H32N2O4S2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane |
| SMILES | CC.CCN(CC)C(=O)C1Sc2ccccc2-c2c1c1ccccc1n2CCOS(C)(=O)=O |
| InChI | InChI=1S/C23H26N2O4S2.C2H6/c1-4-24(5-2)23(26)22-20-16-10-6-8-12-18(16)25(14-15-29-31(3,27)28)21(20)17-11-7-9-13-19(17)30-22;1-2/h6-13,22H,4-5,14-15H2,1-3H3;1-2H3 |
| InChIKey | BAEJEHIENFCWBP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane?
The IUPAC name of 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane (CID 123954152) is 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane.
What is the SMILES notation for 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane?
The canonical SMILES for 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane is CC.CCN(CC)C(=O)C1Sc2ccccc2-c2c1c1ccccc1n2CCOS(C)(=O)=O.
What is the InChIKey of 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane?
The InChIKey is BAEJEHIENFCWBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O4S2.C2H6/c1-4-24(5-2)23(26)22-20-16-10-6-8-12-18(16)25(14-15-29-31(3,27)28)21(20)17-11-7-9-13-19(17)30-22;1-2/h6-13,22H,4-5,14-15H2,1-3H3;1-2H3.
What are the key properties of 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane?
2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane has a molecular weight of 488.68 g/mol, XLogP of 5.33, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(diethylcarbamoyl)-6H-thiochromeno[4,3-b]indol-11-yl]ethyl methanesulfonate;ethane is sourced from PubChem (CID 123954152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).