About 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate
2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate (PubChem CID 123954884) has the molecular formula C12H18F2N2O3
and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate.
Molecular Properties
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate |
| PubChem CID | 123954884 |
| Molecular Formula | C12H18F2N2O3 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate |
| SMILES | [H]/N=C(/C=CC(=O)OCCN1CCC(F)(F)CC1)OC |
| InChI | InChI=1S/C12H18F2N2O3/c1-18-10(15)2-3-11(17)19-9-8-16-6-4-12(13,14)5-7-16/h2-3,15H,4-9H2,1H3/b3-2?,15-10- |
| InChIKey | VWPHXRNQARSNMX-ICCBWTHDSA-N |
| XLogP | 1.44 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate?
The IUPAC name of 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate (CID 123954884) is 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate.
What is the SMILES notation for 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate?
The canonical SMILES for 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate is [H]/N=C(/C=CC(=O)OCCN1CCC(F)(F)CC1)OC.
What is the InChIKey of 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate?
The InChIKey is VWPHXRNQARSNMX-ICCBWTHDSA-N. The full InChI is InChI=1S/C12H18F2N2O3/c1-18-10(15)2-3-11(17)19-9-8-16-6-4-12(13,14)5-7-16/h2-3,15H,4-9H2,1H3/b3-2?,15-10-.
What are the key properties of 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate?
2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate has a molecular weight of 276.28 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoropiperidin-1-yl)ethyl 4-imino-4-methoxybut-2-enoate is sourced from PubChem (CID 123954884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).