C31H27BN2O2S — CID 123954899
2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-1,3-benzothiazole (PubChem CID 123954899) has the molecular formula C31H27BN2O2S and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 123954899 |
| Molecular Formula | C31H27BN2O2S |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-9-yl]phenyl]-1,3-benzothiazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3nc4ccccc4s3)cc2)OC1(C)C |
| InChI | InChI=1S/C31H27BN2O2S/c1-30(2)31(3,4)36-32(35-30)21-15-18-27-24(19-21)23-9-5-7-11-26(23)34(27)22-16-13-20(14-17-22)29-33-25-10-6-8-12-28(25)37-29/h5-19H,1-4H3 |
| InChIKey | LWDSZJGYFUFVDY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|