C14H20F4O2S — CID 123955681
1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfinic acid (PubChem CID 123955681) has the molecular formula C14H20F4O2S and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfinic acid.
| Compound Name | 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfinic acid |
|---|---|
| PubChem CID | 123955681 |
| Molecular Formula | C14H20F4O2S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfinic acid |
| SMILES | O=S(O)C(CC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H20F4O2S/c15-12(16)14(17,18)7-11(21(19)20)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-12H,1-7H2,(H,19,20) |
| InChIKey | MMDQAMYAXPTVJO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|