About 2,3,6,7-tetrachloroanthracene
2,3,6,7-tetrachloroanthracene (PubChem CID 123956225) has the molecular formula C14H6Cl4
and a molecular weight of 316.01 g/mol. Its IUPAC name is 2,3,6,7-tetrachloroanthracene.
Molecular Properties
| Compound Name | 2,3,6,7-tetrachloroanthracene |
| PubChem CID | 123956225 |
| Molecular Formula | C14H6Cl4 |
| Molecular Weight | 316.01 g/mol |
| Exact Mass | 313.92 |
| IUPAC Name | 2,3,6,7-tetrachloroanthracene |
| SMILES | Clc1cc2cc3cc(Cl)c(Cl)cc3cc2cc1Cl |
| InChI | InChI=1S/C14H6Cl4/c15-11-3-7-1-8-4-12(16)14(18)6-10(8)2-9(7)5-13(11)17/h1-6H |
| InChIKey | VPNMYNHJUBCOHA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.01 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3,6,7-tetrachloroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6,7-tetrachloroanthracene?
The IUPAC name of 2,3,6,7-tetrachloroanthracene (CID 123956225) is 2,3,6,7-tetrachloroanthracene.
What is the SMILES notation for 2,3,6,7-tetrachloroanthracene?
The canonical SMILES for 2,3,6,7-tetrachloroanthracene is Clc1cc2cc3cc(Cl)c(Cl)cc3cc2cc1Cl.
What is the InChIKey of 2,3,6,7-tetrachloroanthracene?
The InChIKey is VPNMYNHJUBCOHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Cl4/c15-11-3-7-1-8-4-12(16)14(18)6-10(8)2-9(7)5-13(11)17/h1-6H.
What are the key properties of 2,3,6,7-tetrachloroanthracene?
2,3,6,7-tetrachloroanthracene has a molecular weight of 316.01 g/mol, XLogP of 6.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6,7-tetrachloroanthracene is sourced from PubChem (CID 123956225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).