C11H16Cl2N2O2 — CID 123957452
N-[1,3-dichloro-1-(2-methylpropylideneamino)buta-1,3-dien-2-yl]-2-methoxyacetamide (PubChem CID 123957452) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is N-[1,3-dichloro-1-(2-methylpropylideneamino)buta-1,3-dien-2-yl]-2-methoxyacetamide.
| Compound Name | N-[1,3-dichloro-1-(2-methylpropylideneamino)buta-1,3-dien-2-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 123957452 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-[1,3-dichloro-1-(2-methylpropylideneamino)buta-1,3-dien-2-yl]-2-methoxyacetamide |
| SMILES | C=C(Cl)C(NC(=O)COC)=C(Cl)N=CC(C)C |
| InChI | InChI=1S/C11H16Cl2N2O2/c1-7(2)5-14-11(13)10(8(3)12)15-9(16)6-17-4/h5,7H,3,6H2,1-2,4H3,(H,15,16) |
| InChIKey | MEGLLHAPQFZYDI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|