C23H21Cl3F3N4+ — CID 123957549
aminomethylidene-[[2-cyano-6-methyl-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-propylazanium (PubChem CID 123957549) has the molecular formula C23H21Cl3F3N4+ and a molecular weight of 516.80 g/mol. Its IUPAC name is aminomethylidene-[[2-cyano-6-methyl-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-propylazanium.
| Compound Name | aminomethylidene-[[2-cyano-6-methyl-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-propylazanium |
|---|---|
| PubChem CID | 123957549 |
| Molecular Formula | C23H21Cl3F3N4+ |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | aminomethylidene-[[2-cyano-6-methyl-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]-propylazanium |
| SMILES | CCC[N+](/C=N/c1c(C)cc(C=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C#N)=C\N |
| InChI | InChI=1S/C23H20Cl3F3N4/c1-3-6-33(12-31)13-32-22-14(2)7-15(8-17(22)11-30)4-5-18(23(27,28)29)16-9-19(24)21(26)20(25)10-16/h4-5,7-10,12-13,18,31H,3,6H2,1-2H3/p+1/b5-4?,32-13+ |
| InChIKey | JNZPUECUXCAJFT-QFVHSEBKSA-O |
| XLogP | 7.26 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|