About 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine
3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine (PubChem CID 123957865) has the molecular formula C9H14BrNOS
and a molecular weight of 264.19 g/mol. Its IUPAC name is 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine.
Molecular Properties
| Compound Name | 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine |
| PubChem CID | 123957865 |
| Molecular Formula | C9H14BrNOS |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine |
| SMILES | C=CCC=C(Br)C(C)=NS(=C)(C)=O |
| InChI | InChI=1S/C9H14BrNOS/c1-5-6-7-9(10)8(2)11-13(3,4)12/h5,7H,1,3,6H2,2,4H3 |
| InChIKey | TWAWXIXQQKXYPI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine?
The IUPAC name of 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine (CID 123957865) is 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine.
What is the SMILES notation for 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine?
The canonical SMILES for 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine is C=CCC=C(Br)C(C)=NS(=C)(C)=O.
What is the InChIKey of 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine?
The InChIKey is TWAWXIXQQKXYPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrNOS/c1-5-6-7-9(10)8(2)11-13(3,4)12/h5,7H,1,3,6H2,2,4H3.
What are the key properties of 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine?
3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine has a molecular weight of 264.19 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(methyl-methylidene-oxo-λ6-sulfanyl)hepta-3,6-dien-2-imine is sourced from PubChem (CID 123957865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).