About 5-(methoxymethyl)hepta-2,4-diene
5-(methoxymethyl)hepta-2,4-diene (PubChem CID 123958176) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 5-(methoxymethyl)hepta-2,4-diene.
Molecular Properties
| Compound Name | 5-(methoxymethyl)hepta-2,4-diene |
| PubChem CID | 123958176 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 5-(methoxymethyl)hepta-2,4-diene |
| SMILES | CC=CC=C(CC)COC |
| InChI | InChI=1S/C9H16O/c1-4-6-7-9(5-2)8-10-3/h4,6-7H,5,8H2,1-3H3 |
| InChIKey | XHVHZESOKYJLHJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethyl)hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)hepta-2,4-diene?
The IUPAC name of 5-(methoxymethyl)hepta-2,4-diene (CID 123958176) is 5-(methoxymethyl)hepta-2,4-diene.
What is the SMILES notation for 5-(methoxymethyl)hepta-2,4-diene?
The canonical SMILES for 5-(methoxymethyl)hepta-2,4-diene is CC=CC=C(CC)COC.
What is the InChIKey of 5-(methoxymethyl)hepta-2,4-diene?
The InChIKey is XHVHZESOKYJLHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-4-6-7-9(5-2)8-10-3/h4,6-7H,5,8H2,1-3H3.
What are the key properties of 5-(methoxymethyl)hepta-2,4-diene?
5-(methoxymethyl)hepta-2,4-diene has a molecular weight of 140.23 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)hepta-2,4-diene is sourced from PubChem (CID 123958176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).