About 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane
2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane (PubChem CID 123958340) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane |
| PubChem CID | 123958340 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane |
| SMILES | CC1(C)OCC(CN=O)O1 |
| InChI | InChI=1S/C6H11NO3/c1-6(2)9-4-5(10-6)3-7-8/h5H,3-4H2,1-2H3 |
| InChIKey | WOQHSVYLICKDES-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane?
The IUPAC name of 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane (CID 123958340) is 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane.
What is the SMILES notation for 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane?
The canonical SMILES for 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane is CC1(C)OCC(CN=O)O1.
What is the InChIKey of 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane?
The InChIKey is WOQHSVYLICKDES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-6(2)9-4-5(10-6)3-7-8/h5H,3-4H2,1-2H3.
What are the key properties of 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane?
2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane has a molecular weight of 145.16 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-(nitrosomethyl)-1,3-dioxolane is sourced from PubChem (CID 123958340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).