C24H25FN4O — CID 123958471
8-[4-[(5-fluoro-2-pyridinyl)methoxy]-2H-pyridin-1-yl]-10-methyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indole (PubChem CID 123958471) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is 8-[4-[(5-fluoro-2-pyridinyl)methoxy]-2H-pyridin-1-yl]-10-methyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indole.
| Compound Name | 8-[4-[(5-fluoro-2-pyridinyl)methoxy]-2H-pyridin-1-yl]-10-methyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indole |
|---|---|
| PubChem CID | 123958471 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 8-[4-[(5-fluoro-2-pyridinyl)methoxy]-2H-pyridin-1-yl]-10-methyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indole |
| SMILES | Cn1c2c(c3ccc(N4C=CC(OCc5ccc(F)cn5)=CC4)cc31)CCCNC2 |
| InChI | InChI=1S/C24H25FN4O/c1-28-23-13-19(6-7-22(23)21-3-2-10-26-15-24(21)28)29-11-8-20(9-12-29)30-16-18-5-4-17(25)14-27-18/h4-9,11,13-14,26H,2-3,10,12,15-16H2,1H3 |
| InChIKey | HJUSOTQUTUKJRH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|