C25H47F2N7O — CID 123958953
4-amino-9-fluoro-N-(5-fluoro-4-piperazin-1-ylpiperidin-3-yl)-6-hexan-2-yl-2-methyl-1,2,3,4,7,8,9,10-octahydro-1,5-diazecine-3-carboxamide (PubChem CID 123958953) has the molecular formula C25H47F2N7O and a molecular weight of 499.70 g/mol. Its IUPAC name is 4-amino-9-fluoro-N-(5-fluoro-4-piperazin-1-ylpiperidin-3-yl)-6-hexan-2-yl-2-methyl-1,2,3,4,7,8,9,10-octahydro-1,5-diazecine-3-carboxamide.
| Compound Name | 4-amino-9-fluoro-N-(5-fluoro-4-piperazin-1-ylpiperidin-3-yl)-6-hexan-2-yl-2-methyl-1,2,3,4,7,8,9,10-octahydro-1,5-diazecine-3-carboxamide |
|---|---|
| PubChem CID | 123958953 |
| Molecular Formula | C25H47F2N7O |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.38 |
| IUPAC Name | 4-amino-9-fluoro-N-(5-fluoro-4-piperazin-1-ylpiperidin-3-yl)-6-hexan-2-yl-2-methyl-1,2,3,4,7,8,9,10-octahydro-1,5-diazecine-3-carboxamide |
| SMILES | CCCCC(C)C1=NC(N)C(C(=O)NC2CNCC(F)C2N2CCNCC2)C(C)NCC(F)CC1 |
| InChI | InChI=1S/C25H47F2N7O/c1-4-5-6-16(2)20-8-7-18(26)13-31-17(3)22(24(28)32-20)25(35)33-21-15-30-14-19(27)23(21)34-11-9-29-10-12-34/h16-19,21-24,29-31H,4-15,28H2,1-3H3,(H,33,35) |
| InChIKey | GXJSJSPHLTWGOY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 106.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |