C22H24O3S — CID 123958991
5-cyclohexyl-2-methyl-3-(4-methylphenyl)sulfonyl-1-benzofuran (PubChem CID 123958991) has the molecular formula C22H24O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 5-cyclohexyl-2-methyl-3-(4-methylphenyl)sulfonyl-1-benzofuran.
| Compound Name | 5-cyclohexyl-2-methyl-3-(4-methylphenyl)sulfonyl-1-benzofuran |
|---|---|
| PubChem CID | 123958991 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 5-cyclohexyl-2-methyl-3-(4-methylphenyl)sulfonyl-1-benzofuran |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)oc3ccc(C4CCCCC4)cc23)cc1 |
| InChI | InChI=1S/C22H24O3S/c1-15-8-11-19(12-9-15)26(23,24)22-16(2)25-21-13-10-18(14-20(21)22)17-6-4-3-5-7-17/h8-14,17H,3-7H2,1-2H3 |
| InChIKey | IQFNHYQXJYKTTN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |