C17H36Si — CID 123959029
tert-butyl-dimethyl-(2,2,5,5-tetramethylhept-6-en-3-yl)silane (PubChem CID 123959029) has the molecular formula C17H36Si and a molecular weight of 268.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,2,5,5-tetramethylhept-6-en-3-yl)silane.
| Compound Name | tert-butyl-dimethyl-(2,2,5,5-tetramethylhept-6-en-3-yl)silane |
|---|---|
| PubChem CID | 123959029 |
| Molecular Formula | C17H36Si |
| Molecular Weight | 268.56 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | tert-butyl-dimethyl-(2,2,5,5-tetramethylhept-6-en-3-yl)silane |
| SMILES | C=CC(C)(C)CC(C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36Si/c1-12-17(8,9)13-14(15(2,3)4)18(10,11)16(5,6)7/h12,14H,1,13H2,2-11H3 |
| InChIKey | FDAVBUNAYPXDEQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|