About heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane
heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane (PubChem CID 123959771) has the molecular formula C16H20
and a molecular weight of 212.34 g/mol. Its IUPAC name is heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane.
Analyze heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane?
The IUPAC name of heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane (CID 123959771) is heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane.
What is the SMILES notation for heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane?
The canonical SMILES for heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane is C1C2CC34CC1C3C1C3C5CC2CC5C3C14.
What is the InChIKey of heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane?
The InChIKey is WCYOMQZHWMKIIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20/c1-7-4-16-5-8(1)14(16)13-11-9-2-6(7)3-10(9)12(11)15(13)16/h6-15H,1-5H2.
What are the key properties of heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane?
heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane has a molecular weight of 212.34 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptacyclo[10.3.1.01,11.02,10.03,9.04,8.06,14]hexadecane is sourced from PubChem (CID 123959771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).