methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate

C12H18O5 — CID 123959900

IUPACmethyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate
SMILESCOC(=O)C=CCC1COCCC12OCCO2
InChIInChI=1S/C12H18O5/c1-14-11(13)4-2-3-10-9-15-6-5-12(10)16-7-8-17-12/h2,4,10H,3,5-9H2,1H3
InChIKeyXTVXRRHQLQUWHA-UHFFFAOYSA-N
MW242.27 g/mol
LogP0.89
Rot. Bonds3

About methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate

methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate (PubChem CID 123959900) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate.

Molecular Properties

Compound Namemethyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate
PubChem CID123959900
Molecular FormulaC12H18O5
Molecular Weight242.27 g/mol
Exact Mass242.12
IUPAC Namemethyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate
SMILESCOC(=O)C=CCC1COCCC12OCCO2
InChIInChI=1S/C12H18O5/c1-14-11(13)4-2-3-10-9-15-6-5-12(10)16-7-8-17-12/h2,4,10H,3,5-9H2,1H3
InChIKeyXTVXRRHQLQUWHA-UHFFFAOYSA-N
XLogP0.89
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.27
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate?
The IUPAC name of methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate (CID 123959900) is methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate.
What is the SMILES notation for methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate?
The canonical SMILES for methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate is COC(=O)C=CCC1COCCC12OCCO2.
What is the InChIKey of methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate?
The InChIKey is XTVXRRHQLQUWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O5/c1-14-11(13)4-2-3-10-9-15-6-5-12(10)16-7-8-17-12/h2,4,10H,3,5-9H2,1H3.
What are the key properties of methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate?
methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate has a molecular weight of 242.27 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate is sourced from PubChem (CID 123959900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).