C12H18O5 — CID 123959900
methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate (PubChem CID 123959900) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate.
| Compound Name | methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate |
|---|---|
| PubChem CID | 123959900 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methyl 4-(1,4,8-trioxaspiro[4.5]decan-6-yl)but-2-enoate |
| SMILES | COC(=O)C=CCC1COCCC12OCCO2 |
| InChI | InChI=1S/C12H18O5/c1-14-11(13)4-2-3-10-9-15-6-5-12(10)16-7-8-17-12/h2,4,10H,3,5-9H2,1H3 |
| InChIKey | XTVXRRHQLQUWHA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|