About 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine
4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine (PubChem CID 123960132) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine |
| PubChem CID | 123960132 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=CC(C2=NN(C)CC2)=CCC1 |
| InChI | InChI=1S/C11H15N3/c1-14-8-7-11(13-14)9-3-2-4-10(12)6-5-9/h3,5-6,12H,2,4,7-8H2,1H3/b12-10+ |
| InChIKey | FYTXYIIXQHZLSX-ZRDIBKRKSA-N |
| XLogP | 1.97 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine?
The IUPAC name of 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine (CID 123960132) is 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine.
What is the SMILES notation for 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine?
The canonical SMILES for 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine is [H]/N=C1/C=CC(C2=NN(C)CC2)=CCC1.
What is the InChIKey of 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine?
The InChIKey is FYTXYIIXQHZLSX-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H15N3/c1-14-8-7-11(13-14)9-3-2-4-10(12)6-5-9/h3,5-6,12H,2,4,7-8H2,1H3/b12-10+.
What are the key properties of 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine?
4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine has a molecular weight of 189.26 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-3,4-dihydropyrazol-5-yl)cyclohepta-2,4-dien-1-imine is sourced from PubChem (CID 123960132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).