C16H22ClFN6S — CID 123960165
3-(3-amino-2-chlorophenyl)sulfanyl-6-N-(4-amino-3-fluorobutyl)-6-N-ethylpyrazine-2,6-diamine (PubChem CID 123960165) has the molecular formula C16H22ClFN6S and a molecular weight of 384.91 g/mol. Its IUPAC name is 3-(3-amino-2-chlorophenyl)sulfanyl-6-N-(4-amino-3-fluorobutyl)-6-N-ethylpyrazine-2,6-diamine.
| Compound Name | 3-(3-amino-2-chlorophenyl)sulfanyl-6-N-(4-amino-3-fluorobutyl)-6-N-ethylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 123960165 |
| Molecular Formula | C16H22ClFN6S |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-(3-amino-2-chlorophenyl)sulfanyl-6-N-(4-amino-3-fluorobutyl)-6-N-ethylpyrazine-2,6-diamine |
| SMILES | CCN(CCC(F)CN)c1cnc(Sc2cccc(N)c2Cl)c(N)n1 |
| InChI | InChI=1S/C16H22ClFN6S/c1-2-24(7-6-10(18)8-19)13-9-22-16(15(21)23-13)25-12-5-3-4-11(20)14(12)17/h3-5,9-10H,2,6-8,19-20H2,1H3,(H2,21,23) |
| InChIKey | RNUFLNVWIRJEIS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|