C12H24O7 — CID 123960321
[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,3,4-trimethylheptyl] acetate (PubChem CID 123960321) has the molecular formula C12H24O7 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,3,4-trimethylheptyl] acetate.
| Compound Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,3,4-trimethylheptyl] acetate |
|---|---|
| PubChem CID | 123960321 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-2,3,4-trimethylheptyl] acetate |
| SMILES | CC(=O)OC[C@](C)(O)[C@@](C)(O)[C@](C)(O)[C@H](O)C(C)O |
| InChI | InChI=1S/C12H24O7/c1-7(13)9(15)11(4,17)12(5,18)10(3,16)6-19-8(2)14/h7,9,13,15-18H,6H2,1-5H3/t7?,9-,10+,11-,12-/m1/s1 |
| InChIKey | XJZFMVQYGSWSCB-DDRLPIAMSA-N |
| XLogP | -1.46 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |