About 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine
4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine (PubChem CID 123960520) has the molecular formula C8H10N5+
and a molecular weight of 176.20 g/mol. Its IUPAC name is 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine |
| PubChem CID | 123960520 |
| Molecular Formula | C8H10N5+ |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine |
| SMILES | Cc1ncncc1-n1cnc[n+]1C |
| InChI | InChI=1S/C8H10N5/c1-7-8(3-9-4-11-7)13-6-10-5-12(13)2/h3-6H,1-2H3/q+1 |
| InChIKey | FESAJHQIKLIZKY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine?
The IUPAC name of 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine (CID 123960520) is 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine.
What is the SMILES notation for 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine?
The canonical SMILES for 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine is Cc1ncncc1-n1cnc[n+]1C.
What is the InChIKey of 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine?
The InChIKey is FESAJHQIKLIZKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N5/c1-7-8(3-9-4-11-7)13-6-10-5-12(13)2/h3-6H,1-2H3/q+1.
What are the key properties of 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine?
4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine has a molecular weight of 176.20 g/mol, XLogP of -0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine is sourced from PubChem (CID 123960520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).