C8H10N5+ — CID 123960520
4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine (PubChem CID 123960520) has the molecular formula C8H10N5+ and a molecular weight of 176.20 g/mol. Its IUPAC name is 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine.
| Compound Name | 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine |
|---|---|
| PubChem CID | 123960520 |
| Molecular Formula | C8H10N5+ |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-methyl-5-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyrimidine |
| SMILES | Cc1ncncc1-n1cnc[n+]1C |
| InChI | InChI=1S/C8H10N5/c1-7-8(3-9-4-11-7)13-6-10-5-12(13)2/h3-6H,1-2H3/q+1 |
| InChIKey | FESAJHQIKLIZKY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|